About 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine
1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine (PubChem CID 159368592) has the molecular formula C35H30BrN3
and a molecular weight of 572.55 g/mol. Its IUPAC name is 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine.
Molecular Properties
| Compound Name | 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine |
| PubChem CID | 159368592 |
| Molecular Formula | C35H30BrN3 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine |
| SMILES | Brc1cccc(-c2ccccc2)c1.Nc1cccnc1.c1ccc(-c2cccc(Cc3cccnc3)c2)cc1 |
| InChI | InChI=1S/C18H15N.C12H9Br.C5H6N2/c1-2-8-17(9-3-1)18-10-4-6-15(13-18)12-16-7-5-11-19-14-16;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;6-5-2-1-3-7-4-5/h1-11,13-14H,12H2;1-9H;1-4H,6H2 |
| InChIKey | LJLGTXIECMSOCR-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine?
The IUPAC name of 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine (CID 159368592) is 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine.
What is the SMILES notation for 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine?
The canonical SMILES for 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine is Brc1cccc(-c2ccccc2)c1.Nc1cccnc1.c1ccc(-c2cccc(Cc3cccnc3)c2)cc1.
What is the InChIKey of 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine?
The InChIKey is LJLGTXIECMSOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C12H9Br.C5H6N2/c1-2-8-17(9-3-1)18-10-4-6-15(13-18)12-16-7-5-11-19-14-16;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;6-5-2-1-3-7-4-5/h1-11,13-14H,12H2;1-9H;1-4H,6H2.
What are the key properties of 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine?
1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine has a molecular weight of 572.55 g/mol, XLogP of 9.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-phenylbenzene;3-[(3-phenylphenyl)methyl]pyridine;pyridin-3-amine is sourced from PubChem (CID 159368592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).