C27H32F6N2O2S — CID 143245402
(5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-(methylsulfanylmethyl)-1,4-diazabicyclo[3.3.1]nonan-3-one (PubChem CID 143245402) has the molecular formula C27H32F6N2O2S and a molecular weight of 562.62 g/mol. Its IUPAC name is (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-(methylsulfanylmethyl)-1,4-diazabicyclo[3.3.1]nonan-3-one.
| Compound Name | (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-(methylsulfanylmethyl)-1,4-diazabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 143245402 |
| Molecular Formula | C27H32F6N2O2S |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-(methylsulfanylmethyl)-1,4-diazabicyclo[3.3.1]nonan-3-one |
| SMILES | C=C(/C=C\C=C/C)[C@]1(CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@]2(CSC)CN1CC(=O)N2 |
| InChI | InChI=1S/C27H32F6N2O2S/c1-5-6-7-8-18(2)25(10-9-24(17-38-4)15-35(25)14-23(36)34-24)16-37-19(3)20-11-21(26(28,29)30)13-22(12-20)27(31,32)33/h5-8,11-13,19H,2,9-10,14-17H2,1,3-4H3,(H,34,36)/b6-5-,8-7-/t19-,24-,25-/m1/s1 |
| InChIKey | FOZDERNRRBLUBY-ALFRBUBWSA-N |
| XLogP | 6.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|