C17H29NS — CID 143245980
ethane;N-[(4-methyl-3-propylphenyl)methyl]-3-methylsulfanylprop-1-en-2-amine (PubChem CID 143245980) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is ethane;N-[(4-methyl-3-propylphenyl)methyl]-3-methylsulfanylprop-1-en-2-amine.
| Compound Name | ethane;N-[(4-methyl-3-propylphenyl)methyl]-3-methylsulfanylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143245980 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | ethane;N-[(4-methyl-3-propylphenyl)methyl]-3-methylsulfanylprop-1-en-2-amine |
| SMILES | C=C(CSC)NCc1ccc(C)c(CCC)c1.CC |
| InChI | InChI=1S/C15H23NS.C2H6/c1-5-6-15-9-14(8-7-12(15)2)10-16-13(3)11-17-4;1-2/h7-9,16H,3,5-6,10-11H2,1-2,4H3;1-2H3 |
| InChIKey | GLFGNYVPVXAWPM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |