C20H31NO — CID 143246576
(2E)-2-[cyclopropyl-(2,4,4-trimethylcyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide (PubChem CID 143246576) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (2E)-2-[cyclopropyl-(2,4,4-trimethylcyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide.
| Compound Name | (2E)-2-[cyclopropyl-(2,4,4-trimethylcyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide |
|---|---|
| PubChem CID | 143246576 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (2E)-2-[cyclopropyl-(2,4,4-trimethylcyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide |
| SMILES | C=C(C)/C(C(=O)NCC)=C(\C1=C(C)CC(C)(C)CC1)C1CC1 |
| InChI | InChI=1S/C20H31NO/c1-7-21-19(22)17(13(2)3)18(15-8-9-15)16-10-11-20(5,6)12-14(16)4/h15H,2,7-12H2,1,3-6H3,(H,21,22)/b18-17+ |
| InChIKey | IATGPHKHGGRGLZ-ISLYRVAYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|