C21H31NO — CID 143246784
(2E)-2-[cyclopropyl-(2,4,4-trimethyl-6-methylidenecyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide (PubChem CID 143246784) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (2E)-2-[cyclopropyl-(2,4,4-trimethyl-6-methylidenecyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide.
| Compound Name | (2E)-2-[cyclopropyl-(2,4,4-trimethyl-6-methylidenecyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide |
|---|---|
| PubChem CID | 143246784 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (2E)-2-[cyclopropyl-(2,4,4-trimethyl-6-methylidenecyclohexen-1-yl)methylidene]-N-ethyl-3-methylbut-3-enamide |
| SMILES | C=C1CC(C)(C)CC(C)=C1/C(=C(\C(=C)C)C(=O)NCC)C1CC1 |
| InChI | InChI=1S/C21H31NO/c1-8-22-20(23)17(13(2)3)19(16-9-10-16)18-14(4)11-21(6,7)12-15(18)5/h16H,2,4,8-12H2,1,3,5-7H3,(H,22,23)/b19-17+ |
| InChIKey | DRBKECITYJJCSN-HTXNQAPBSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|