C23H41N3O4S — CID 143248485
4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;N-propylsulfanylpyrrolidin-3-amine (PubChem CID 143248485) has the molecular formula C23H41N3O4S and a molecular weight of 455.67 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;N-propylsulfanylpyrrolidin-3-amine.
| Compound Name | 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;N-propylsulfanylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 143248485 |
| Molecular Formula | C23H41N3O4S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;N-propylsulfanylpyrrolidin-3-amine |
| SMILES | CCCSNC1CCNC1.COCCCOc1cc(C(=O)N(C)C(C)C)ccc1OC |
| InChI | InChI=1S/C16H25NO4.C7H16N2S/c1-12(2)17(3)16(18)13-7-8-14(20-5)15(11-13)21-10-6-9-19-4;1-2-5-10-9-7-3-4-8-6-7/h7-8,11-12H,6,9-10H2,1-5H3;7-9H,2-6H2,1H3 |
| InChIKey | VQFFIOORZCUVFF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|