C29H47N3O4 — CID 143294798
4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;(3Z,5Z)-N-(pyrrolidin-3-ylmethyl)octa-3,5,7-trien-2-amine (PubChem CID 143294798) has the molecular formula C29H47N3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;(3Z,5Z)-N-(pyrrolidin-3-ylmethyl)octa-3,5,7-trien-2-amine.
| Compound Name | 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;(3Z,5Z)-N-(pyrrolidin-3-ylmethyl)octa-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 143294798 |
| Molecular Formula | C29H47N3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | 4-methoxy-3-(3-methoxypropoxy)-N-methyl-N-propan-2-ylbenzamide;(3Z,5Z)-N-(pyrrolidin-3-ylmethyl)octa-3,5,7-trien-2-amine |
| SMILES | C=C/C=C\C=C/C(C)NCC1CCNC1.COCCCOc1cc(C(=O)N(C)C(C)C)ccc1OC |
| InChI | InChI=1S/C16H25NO4.C13H22N2/c1-12(2)17(3)16(18)13-7-8-14(20-5)15(11-13)21-10-6-9-19-4;1-3-4-5-6-7-12(2)15-11-13-8-9-14-10-13/h7-8,11-12H,6,9-10H2,1-5H3;3-7,12-15H,1,8-11H2,2H3/b;5-4-,7-6- |
| InChIKey | HJGCPSRNBLYGGB-ZBRBURFXSA-N |
| XLogP | 4.46 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|