About 3-iodo-3-methyl-1,2-benzodiazepine
3-iodo-3-methyl-1,2-benzodiazepine (PubChem CID 143248631) has the molecular formula C10H9IN2
and a molecular weight of 284.10 g/mol. Its IUPAC name is 3-iodo-3-methyl-1,2-benzodiazepine.
Molecular Properties
| Compound Name | 3-iodo-3-methyl-1,2-benzodiazepine |
| PubChem CID | 143248631 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 3-iodo-3-methyl-1,2-benzodiazepine |
| SMILES | CC1(I)C=Cc2ccccc2N=N1 |
| InChI | InChI=1S/C10H9IN2/c1-10(11)7-6-8-4-2-3-5-9(8)12-13-10/h2-7H,1H3 |
| InChIKey | INQNCDPUIPGTSB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-3-methyl-1,2-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-3-methyl-1,2-benzodiazepine?
The IUPAC name of 3-iodo-3-methyl-1,2-benzodiazepine (CID 143248631) is 3-iodo-3-methyl-1,2-benzodiazepine.
What is the SMILES notation for 3-iodo-3-methyl-1,2-benzodiazepine?
The canonical SMILES for 3-iodo-3-methyl-1,2-benzodiazepine is CC1(I)C=Cc2ccccc2N=N1.
What is the InChIKey of 3-iodo-3-methyl-1,2-benzodiazepine?
The InChIKey is INQNCDPUIPGTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2/c1-10(11)7-6-8-4-2-3-5-9(8)12-13-10/h2-7H,1H3.
What are the key properties of 3-iodo-3-methyl-1,2-benzodiazepine?
3-iodo-3-methyl-1,2-benzodiazepine has a molecular weight of 284.10 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-3-methyl-1,2-benzodiazepine is sourced from PubChem (CID 143248631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).