C11H8N2O — CID 140836179
(4Z,6Z)-1,2-benzodiazonin-3-one (PubChem CID 140836179) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is (4Z,6Z)-1,2-benzodiazonin-3-one.
| Compound Name | (4Z,6Z)-1,2-benzodiazonin-3-one |
|---|---|
| PubChem CID | 140836179 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (4Z,6Z)-1,2-benzodiazonin-3-one |
| SMILES | O=C1/C=C\C=C/c2ccccc2/N=N\1 |
| InChI | InChI=1S/C11H8N2O/c14-11-8-4-2-6-9-5-1-3-7-10(9)12-13-11/h1-8H/b6-2-,8-4-,13-12- |
| InChIKey | WXBHMTGZUFUBGD-NOIUFAIASA-N |
| XLogP | 2.88 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |