C11H12N2 — CID 172688974
azane;1-benzazocine (PubChem CID 172688974) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is azane;1-benzazocine.
| Compound Name | azane;1-benzazocine |
|---|---|
| PubChem CID | 172688974 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | azane;1-benzazocine |
| SMILES | C1=C/C=N\c2ccccc2C=C1.N |
| InChI | InChI=1S/C11H9N.H3N/c1-2-6-10-7-3-4-8-11(10)12-9-5-1;/h1-9H;1H3/b2-1?,5-1?,6-2?,9-5?,10-6?,12-9-,12-11-; |
| InChIKey | BPHAGWRODRHKJR-JYBGBPKOSA-N |
| XLogP | 3.13 |
| TPSA | 47.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |