About 5H-1-benzazocin-6-one
5H-1-benzazocin-6-one (PubChem CID 68704953) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 5H-1-benzazocin-6-one.
Molecular Properties
| Compound Name | 5H-1-benzazocin-6-one |
| PubChem CID | 68704953 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 5H-1-benzazocin-6-one |
| SMILES | O=C1CC=C/C=N\c2ccccc21 |
| InChI | InChI=1S/C11H9NO/c13-11-7-3-4-8-12-10-6-2-1-5-9(10)11/h1-6,8H,7H2/b4-3?,12-8- |
| InChIKey | BFBKWBVHEALGIS-SMVYRRPNSA-N |
| XLogP | 2.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-1-benzazocin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-1-benzazocin-6-one?
The IUPAC name of 5H-1-benzazocin-6-one (CID 68704953) is 5H-1-benzazocin-6-one.
What is the SMILES notation for 5H-1-benzazocin-6-one?
The canonical SMILES for 5H-1-benzazocin-6-one is O=C1CC=C/C=N\c2ccccc21.
What is the InChIKey of 5H-1-benzazocin-6-one?
The InChIKey is BFBKWBVHEALGIS-SMVYRRPNSA-N. The full InChI is InChI=1S/C11H9NO/c13-11-7-3-4-8-12-10-6-2-1-5-9(10)11/h1-6,8H,7H2/b4-3?,12-8-.
What are the key properties of 5H-1-benzazocin-6-one?
5H-1-benzazocin-6-one has a molecular weight of 171.20 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-1-benzazocin-6-one is sourced from PubChem (CID 68704953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).