C19H30N2O — CID 168890236
4,9-dimethyl-2,9-diazabicyclo[9.4.0]pentadeca-1(15),2,6,11,13-pentaen-10-one;ethane (PubChem CID 168890236) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 4,9-dimethyl-2,9-diazabicyclo[9.4.0]pentadeca-1(15),2,6,11,13-pentaen-10-one;ethane.
| Compound Name | 4,9-dimethyl-2,9-diazabicyclo[9.4.0]pentadeca-1(15),2,6,11,13-pentaen-10-one;ethane |
|---|---|
| PubChem CID | 168890236 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 4,9-dimethyl-2,9-diazabicyclo[9.4.0]pentadeca-1(15),2,6,11,13-pentaen-10-one;ethane |
| SMILES | CC.CC.CC1/C=N/c2ccccc2C(=O)N(C)CC=CC1 |
| InChI | InChI=1S/C15H18N2O.2C2H6/c1-12-7-5-6-10-17(2)15(18)13-8-3-4-9-14(13)16-11-12;2*1-2/h3-6,8-9,11-12H,7,10H2,1-2H3;2*1-2H3/b6-5?,16-11+;; |
| InChIKey | PFZZPIVMLFVGPY-HYYDSEDZSA-N |
| XLogP | 5.11 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|