C11H12N2O — CID 144545698
1,3-dimethyl-3H-1,5-benzodiazepin-2-one (PubChem CID 144545698) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 1,3-dimethyl-3H-1,5-benzodiazepin-2-one.
| Compound Name | 1,3-dimethyl-3H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 144545698 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 1,3-dimethyl-3H-1,5-benzodiazepin-2-one |
| SMILES | CC1C=Nc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C11H12N2O/c1-8-7-12-9-5-3-4-6-10(9)13(2)11(8)14/h3-8H,1-2H3 |
| InChIKey | AISRSZAOSRECEI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |