C16H11N3O2 — CID 173283974
2-phenyl-3aH-imidazo[1,5-a]quinoxaline-1,3-dione (PubChem CID 173283974) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-phenyl-3aH-imidazo[1,5-a]quinoxaline-1,3-dione.
| Compound Name | 2-phenyl-3aH-imidazo[1,5-a]quinoxaline-1,3-dione |
|---|---|
| PubChem CID | 173283974 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-phenyl-3aH-imidazo[1,5-a]quinoxaline-1,3-dione |
| SMILES | O=C1C2C=Nc3ccccc3N2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H11N3O2/c20-15-14-10-17-12-8-4-5-9-13(12)19(14)16(21)18(15)11-6-2-1-3-7-11/h1-10,14H |
| InChIKey | JFNDKOULQDWSKY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|