C10H10N2O — CID 71373057
4-methyl-3H-1,4-benzodiazepin-5-one (PubChem CID 71373057) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-methyl-3H-1,4-benzodiazepin-5-one.
| Compound Name | 4-methyl-3H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 71373057 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 4-methyl-3H-1,4-benzodiazepin-5-one |
| SMILES | CN1CC=Nc2ccccc2C1=O |
| InChI | InChI=1S/C10H10N2O/c1-12-7-6-11-9-5-3-2-4-8(9)10(12)13/h2-6H,7H2,1H3 |
| InChIKey | HXHIWKVJVURLAW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |