C11H15NOSi — CID 22754064
1,1,3-trimethyl-2H-3,1-benzazasilin-4-one (PubChem CID 22754064) has the molecular formula C11H15NOSi and a molecular weight of 205.33 g/mol. Its IUPAC name is 1,1,3-trimethyl-2H-3,1-benzazasilin-4-one.
| Compound Name | 1,1,3-trimethyl-2H-3,1-benzazasilin-4-one |
|---|---|
| PubChem CID | 22754064 |
| Molecular Formula | C11H15NOSi |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1,1,3-trimethyl-2H-3,1-benzazasilin-4-one |
| SMILES | CN1C[Si](C)(C)c2ccccc2C1=O |
| InChI | InChI=1S/C11H15NOSi/c1-12-8-14(2,3)10-7-5-4-6-9(10)11(12)13/h4-7H,8H2,1-3H3 |
| InChIKey | IQKQINYGIFJKDH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|