C23H28N8O2S — CID 143249292
1-(4-methylphenyl)-3-[2-[(13-oxo-13λ4-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]urea (PubChem CID 143249292) has the molecular formula C23H28N8O2S and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[2-[(13-oxo-13λ4-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[2-[(13-oxo-13λ4-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 143249292 |
| Molecular Formula | C23H28N8O2S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-(4-methylphenyl)-3-[2-[(13-oxo-13λ4-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCNc2cnc3nc2NCCCNS(=O)c2cccc(c2)N3)cc1 |
| InChI | InChI=1S/C23H28N8O2S/c1-16-6-8-17(9-7-16)30-23(32)26-13-12-24-20-15-27-22-29-18-4-2-5-19(14-18)34(33)28-11-3-10-25-21(20)31-22/h2,4-9,14-15,24,28H,3,10-13H2,1H3,(H2,26,30,32)(H2,25,27,29,31) |
| InChIKey | XUYMXFYRZWZQLI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|