C19H28N8O2S — CID 58752032
3-[2-[(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 58752032) has the molecular formula C19H28N8O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 3-[2-[(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 58752032 |
| Molecular Formula | C19H28N8O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-[2-[(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | [H]N=S1(=O)CCCCNc2nc(ncc2NCCNC(=O)N(C)C)Nc2cccc1c2 |
| InChI | InChI=1S/C19H28N8O2S/c1-27(2)19(28)23-10-9-21-16-13-24-18-25-14-6-5-7-15(12-14)30(20,29)11-4-3-8-22-17(16)26-18/h5-7,12-13,20-21H,3-4,8-11H2,1-2H3,(H,23,28)(H2,22,24,25,26) |
| InChIKey | QMJOPTYZTQGKLA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|