C21H21F2N7O3S — CID 71033862
1-(2,5-difluorophenyl)-3-[(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)methyl]urea (PubChem CID 71033862) has the molecular formula C21H21F2N7O3S and a molecular weight of 489.51 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)methyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)methyl]urea |
|---|---|
| PubChem CID | 71033862 |
| Molecular Formula | C21H21F2N7O3S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)methyl]urea |
| SMILES | O=C(NCc1cnc2nc1NCCCNS(=O)(=O)c1cccc(c1)N2)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C21H21F2N7O3S/c22-14-5-6-17(23)18(9-14)29-21(31)26-12-13-11-25-20-28-15-3-1-4-16(10-15)34(32,33)27-8-2-7-24-19(13)30-20/h1,3-6,9-11,27H,2,7-8,12H2,(H2,26,29,31)(H2,24,25,28,30) |
| InChIKey | WRNWVYSTKGAZTN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |