C23H25Cl2NO — CID 143249938
N-[(1-but-1-en-2-ylcyclopentyl)-phenylmethyl]-2,4-dichlorobenzamide (PubChem CID 143249938) has the molecular formula C23H25Cl2NO and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[(1-but-1-en-2-ylcyclopentyl)-phenylmethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[(1-but-1-en-2-ylcyclopentyl)-phenylmethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 143249938 |
| Molecular Formula | C23H25Cl2NO |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(1-but-1-en-2-ylcyclopentyl)-phenylmethyl]-2,4-dichlorobenzamide |
| SMILES | C=C(CC)C1(C(NC(=O)c2ccc(Cl)cc2Cl)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C23H25Cl2NO/c1-3-16(2)23(13-7-8-14-23)21(17-9-5-4-6-10-17)26-22(27)19-12-11-18(24)15-20(19)25/h4-6,9-12,15,21H,2-3,7-8,13-14H2,1H3,(H,26,27) |
| InChIKey | WMBPKVSBDUKKLY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|