C22H26Cl2N2O — CID 70269882
2,4-dichloro-N-[(R)-phenyl-(1,2,5-trimethylpiperidin-2-yl)methyl]benzamide (PubChem CID 70269882) has the molecular formula C22H26Cl2N2O and a molecular weight of 405.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[(R)-phenyl-(1,2,5-trimethylpiperidin-2-yl)methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(R)-phenyl-(1,2,5-trimethylpiperidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 70269882 |
| Molecular Formula | C22H26Cl2N2O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2,4-dichloro-N-[(R)-phenyl-(1,2,5-trimethylpiperidin-2-yl)methyl]benzamide |
| SMILES | CC1CCC(C)([C@H](NC(=O)c2ccc(Cl)cc2Cl)c2ccccc2)N(C)C1 |
| InChI | InChI=1S/C22H26Cl2N2O/c1-15-11-12-22(2,26(3)14-15)20(16-7-5-4-6-8-16)25-21(27)18-10-9-17(23)13-19(18)24/h4-10,13,15,20H,11-12,14H2,1-3H3,(H,25,27)/t15?,20-,22?/m1/s1 |
| InChIKey | GHXUIAOAIDWHNS-YOMPXFNTSA-N |
| XLogP | 5.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |