C13H19N3O — CID 143252513
(2R,3S,4S)-3-pentyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 143252513) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (2R,3S,4S)-3-pentyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2R,3S,4S)-3-pentyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 143252513 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (2R,3S,4S)-3-pentyl-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CCCCC[C@H]1[C@@H]2Cc3c(C(N)=O)n[nH]c3[C@H]12 |
| InChI | InChI=1S/C13H19N3O/c1-2-3-4-5-7-8-6-9-11(10(7)8)15-16-12(9)13(14)17/h7-8,10H,2-6H2,1H3,(H2,14,17)(H,15,16)/t7-,8-,10+/m0/s1 |
| InChIKey | QENUJKDNLGXVCU-OYNCUSHFSA-N |
| XLogP | 1.97 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|