C13H26N2 — CID 143256208
(3E)-2,5-dimethyl-N-(methylideneamino)hexa-1,3,5-trien-3-amine;ethane (PubChem CID 143256208) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (3E)-2,5-dimethyl-N-(methylideneamino)hexa-1,3,5-trien-3-amine;ethane.
| Compound Name | (3E)-2,5-dimethyl-N-(methylideneamino)hexa-1,3,5-trien-3-amine;ethane |
|---|---|
| PubChem CID | 143256208 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (3E)-2,5-dimethyl-N-(methylideneamino)hexa-1,3,5-trien-3-amine;ethane |
| SMILES | C=NN/C(=C/C(=C)C)C(=C)C.CC.CC |
| InChI | InChI=1S/C9H14N2.2C2H6/c1-7(2)6-9(8(3)4)11-10-5;2*1-2/h6,11H,1,3,5H2,2,4H3;2*1-2H3/b9-6+;; |
| InChIKey | MNBOYNKCEPIULZ-SWSRPJROSA-N |
| XLogP | 4.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|