C8H16N2 — CID 134448934
[(2Z,4E)-3-methylhepta-2,4-dien-4-yl]hydrazine (PubChem CID 134448934) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is [(2Z,4E)-3-methylhepta-2,4-dien-4-yl]hydrazine.
| Compound Name | [(2Z,4E)-3-methylhepta-2,4-dien-4-yl]hydrazine |
|---|---|
| PubChem CID | 134448934 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | [(2Z,4E)-3-methylhepta-2,4-dien-4-yl]hydrazine |
| SMILES | C/C=C(C)\C(=C/CC)NN |
| InChI | InChI=1S/C8H16N2/c1-4-6-8(10-9)7(3)5-2/h5-6,10H,4,9H2,1-3H3/b7-5-,8-6+ |
| InChIKey | AOSKKTRDXAZHKG-CGXWXWIYSA-N |
| XLogP | 1.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|