C22H24N4O — CID 143258450
4-[6-butanimidoyl-5-(methylamino)-2-phenylpyrimidin-4-yl]-2-methylphenol (PubChem CID 143258450) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-[6-butanimidoyl-5-(methylamino)-2-phenylpyrimidin-4-yl]-2-methylphenol.
| Compound Name | 4-[6-butanimidoyl-5-(methylamino)-2-phenylpyrimidin-4-yl]-2-methylphenol |
|---|---|
| PubChem CID | 143258450 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-[6-butanimidoyl-5-(methylamino)-2-phenylpyrimidin-4-yl]-2-methylphenol |
| SMILES | [H]/N=C(\CCC)c1nc(-c2ccccc2)nc(-c2ccc(O)c(C)c2)c1NC |
| InChI | InChI=1S/C22H24N4O/c1-4-8-17(23)20-21(24-3)19(16-11-12-18(27)14(2)13-16)25-22(26-20)15-9-6-5-7-10-15/h5-7,9-13,23-24,27H,4,8H2,1-3H3/b23-17+ |
| InChIKey | PEPHIRITBUKUJI-HAVVHWLPSA-N |
| XLogP | 5.03 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|