C19H35NO2 — CID 143259390
(E)-10-(2-cyclohex-2-en-1-ylethylamino)-9-methyldec-8-ene-1,5-diol (PubChem CID 143259390) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is (E)-10-(2-cyclohex-2-en-1-ylethylamino)-9-methyldec-8-ene-1,5-diol.
| Compound Name | (E)-10-(2-cyclohex-2-en-1-ylethylamino)-9-methyldec-8-ene-1,5-diol |
|---|---|
| PubChem CID | 143259390 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | (E)-10-(2-cyclohex-2-en-1-ylethylamino)-9-methyldec-8-ene-1,5-diol |
| SMILES | C/C(=C\CCC(O)CCCCO)CNCCC1C=CCCC1 |
| InChI | InChI=1S/C19H35NO2/c1-17(8-7-12-19(22)11-5-6-15-21)16-20-14-13-18-9-3-2-4-10-18/h3,8-9,18-22H,2,4-7,10-16H2,1H3/b17-8+ |
| InChIKey | VOLVJFSUZNNIDK-CAOOACKPSA-N |
| XLogP | 3.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|