C15H23Cl2NO — CID 143260168
acetaldehyde;N-[(2,3-dichlorophenyl)methyl]-N-methylcyclopropanamine;ethane (PubChem CID 143260168) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is acetaldehyde;N-[(2,3-dichlorophenyl)methyl]-N-methylcyclopropanamine;ethane.
| Compound Name | acetaldehyde;N-[(2,3-dichlorophenyl)methyl]-N-methylcyclopropanamine;ethane |
|---|---|
| PubChem CID | 143260168 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | acetaldehyde;N-[(2,3-dichlorophenyl)methyl]-N-methylcyclopropanamine;ethane |
| SMILES | CC.CC=O.CN(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C11H13Cl2N.C2H4O.C2H6/c1-14(9-5-6-9)7-8-3-2-4-10(12)11(8)13;1-2-3;1-2/h2-4,9H,5-7H2,1H3;2H,1H3;1-2H3 |
| InChIKey | NHEODLLMPFGNJJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|