C13H19N3 — CID 143262809
ethene;5-methyl-3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-1,2,4-triazole (PubChem CID 143262809) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is ethene;5-methyl-3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-1,2,4-triazole.
| Compound Name | ethene;5-methyl-3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143262809 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | ethene;5-methyl-3-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-1,2,4-triazole |
| SMILES | C=C.C=C/C=C(\C=C/C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H15N3.C2H4/c1-4-6-10(7-5-2)8-11-12-9(3)13-14-11;1-2/h4-7H,1,8H2,2-3H3,(H,12,13,14);1-2H2/b7-5-,10-6+; |
| InChIKey | NNPBZKZFBJWLNC-RQLYHSFASA-N |
| XLogP | 3.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|