C23H31N3OS2 — CID 143265121
(E)-4-(4-aminophenyl)-2-[2-[[(E)-4-(4-methoxyphenyl)-1-sulfanylbut-3-en-2-yl]amino]ethylamino]but-3-ene-1-thiol (PubChem CID 143265121) has the molecular formula C23H31N3OS2 and a molecular weight of 429.66 g/mol. Its IUPAC name is (E)-4-(4-aminophenyl)-2-[2-[[(E)-4-(4-methoxyphenyl)-1-sulfanylbut-3-en-2-yl]amino]ethylamino]but-3-ene-1-thiol.
| Compound Name | (E)-4-(4-aminophenyl)-2-[2-[[(E)-4-(4-methoxyphenyl)-1-sulfanylbut-3-en-2-yl]amino]ethylamino]but-3-ene-1-thiol |
|---|---|
| PubChem CID | 143265121 |
| Molecular Formula | C23H31N3OS2 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (E)-4-(4-aminophenyl)-2-[2-[[(E)-4-(4-methoxyphenyl)-1-sulfanylbut-3-en-2-yl]amino]ethylamino]but-3-ene-1-thiol |
| SMILES | COc1ccc(/C=C/C(CS)NCCNC(/C=C/c2ccc(N)cc2)CS)cc1 |
| InChI | InChI=1S/C23H31N3OS2/c1-27-23-12-6-19(7-13-23)5-11-22(17-29)26-15-14-25-21(16-28)10-4-18-2-8-20(24)9-3-18/h2-13,21-22,25-26,28-29H,14-17,24H2,1H3/b10-4+,11-5+ |
| InChIKey | GYOYLQFIYGEPHZ-ZVSIBQGLSA-N |
| XLogP | 3.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|