C22H24N2O3S — CID 143265994
ethyl (2R,4Z)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoate (PubChem CID 143265994) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is ethyl (2R,4Z)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoate.
| Compound Name | ethyl (2R,4Z)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoate |
|---|---|
| PubChem CID | 143265994 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | ethyl (2R,4Z)-2-[(4-phenyl-1,3-thiazol-2-yl)carbamoyl]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoate |
| SMILES | C=C/C=C(\C=C/C)C[C@H](C(=O)Nc1nc(-c2ccccc2)cs1)C(=O)OCC |
| InChI | InChI=1S/C22H24N2O3S/c1-4-10-16(11-5-2)14-18(21(26)27-6-3)20(25)24-22-23-19(15-28-22)17-12-8-7-9-13-17/h4-5,7-13,15,18H,1,6,14H2,2-3H3,(H,23,24,25)/b11-5-,16-10+/t18-/m1/s1 |
| InChIKey | IVYAVNWRRDFHHY-GAVCXERHSA-N |
| XLogP | 5.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|