C14H13FO2S — CID 143268060
8-fluoro-2-(1-methoxyethyl)-4H-thieno[3,2-c]chromene (PubChem CID 143268060) has the molecular formula C14H13FO2S and a molecular weight of 264.32 g/mol. Its IUPAC name is 8-fluoro-2-(1-methoxyethyl)-4H-thieno[3,2-c]chromene.
| Compound Name | 8-fluoro-2-(1-methoxyethyl)-4H-thieno[3,2-c]chromene |
|---|---|
| PubChem CID | 143268060 |
| Molecular Formula | C14H13FO2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 8-fluoro-2-(1-methoxyethyl)-4H-thieno[3,2-c]chromene |
| SMILES | COC(C)c1cc2c(s1)-c1cc(F)ccc1OC2 |
| InChI | InChI=1S/C14H13FO2S/c1-8(16-2)13-5-9-7-17-12-4-3-10(15)6-11(12)14(9)18-13/h3-6,8H,7H2,1-2H3 |
| InChIKey | VRGCKPUAKJUCQZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |