C22H13ClFN3O2S — CID 44722872
N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-8-fluoro-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 44722872) has the molecular formula C22H13ClFN3O2S and a molecular weight of 437.88 g/mol. Its IUPAC name is N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-8-fluoro-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-8-fluoro-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44722872 |
| Molecular Formula | C22H13ClFN3O2S |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-8-fluoro-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc2ccccc2nc1Cl)c1cc2c(s1)-c1cc(F)ccc1OC2 |
| InChI | InChI=1S/C22H13ClFN3O2S/c23-21-13(7-12-3-1-2-4-17(12)26-21)10-25-27-22(28)19-8-14-11-29-18-6-5-15(24)9-16(18)20(14)30-19/h1-10H,11H2,(H,27,28)/b25-10+ |
| InChIKey | ZFEPCXNVEGOOMK-KIBLKLHPSA-N |
| XLogP | 5.41 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|