C23H15ClN2O4S — CID 44722867
8-chloro-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 44722867) has the molecular formula C23H15ClN2O4S and a molecular weight of 450.90 g/mol. Its IUPAC name is 8-chloro-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | 8-chloro-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44722867 |
| Molecular Formula | C23H15ClN2O4S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 8-chloro-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1ccc2occ(/C=N/NC(=O)c3cc4c(s3)-c3cc(Cl)ccc3OC4)c(=O)c2c1 |
| InChI | InChI=1S/C23H15ClN2O4S/c1-12-2-4-18-16(6-12)21(27)14(11-30-18)9-25-26-23(28)20-7-13-10-29-19-5-3-15(24)8-17(19)22(13)31-20/h2-9,11H,10H2,1H3,(H,26,28)/b25-9+ |
| InChIKey | BHZSLTDLGACZRA-YCPBAFNGSA-N |
| XLogP | 5.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|