C24H18ClN3O3S — CID 44722860
N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-8-methyl-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 44722860) has the molecular formula C24H18ClN3O3S and a molecular weight of 463.95 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-8-methyl-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-8-methyl-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44722860 |
| Molecular Formula | C24H18ClN3O3S |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-8-methyl-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | COc1ccc2nc(Cl)c(/C=N/NC(=O)c3cc4c(s3)-c3cc(C)ccc3OC4)cc2c1 |
| InChI | InChI=1S/C24H18ClN3O3S/c1-13-3-6-20-18(7-13)22-16(12-31-20)10-21(32-22)24(29)28-26-11-15-8-14-9-17(30-2)4-5-19(14)27-23(15)25/h3-11H,12H2,1-2H3,(H,28,29)/b26-11+ |
| InChIKey | NMTIMRZUIJRXMO-KBKYJPHKSA-N |
| XLogP | 5.59 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|