C11H19NO2 — CID 143269538
N-[(2Z,4E)-3-ethyl-1-methoxyhepta-2,4-dien-4-yl]formamide (PubChem CID 143269538) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(2Z,4E)-3-ethyl-1-methoxyhepta-2,4-dien-4-yl]formamide.
| Compound Name | N-[(2Z,4E)-3-ethyl-1-methoxyhepta-2,4-dien-4-yl]formamide |
|---|---|
| PubChem CID | 143269538 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-[(2Z,4E)-3-ethyl-1-methoxyhepta-2,4-dien-4-yl]formamide |
| SMILES | CC/C=C(NC=O)\C(=C/COC)CC |
| InChI | InChI=1S/C11H19NO2/c1-4-6-11(12-9-13)10(5-2)7-8-14-3/h6-7,9H,4-5,8H2,1-3H3,(H,12,13)/b10-7-,11-6+ |
| InChIKey | WRHPQWNZOSURBZ-IKVLVDHLSA-N |
| XLogP | 2.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|