C10H17NO2 — CID 143087945
N-[(Z,2E)-2-(2-methoxyethylidene)hex-3-enyl]formamide (PubChem CID 143087945) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(Z,2E)-2-(2-methoxyethylidene)hex-3-enyl]formamide.
| Compound Name | N-[(Z,2E)-2-(2-methoxyethylidene)hex-3-enyl]formamide |
|---|---|
| PubChem CID | 143087945 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-[(Z,2E)-2-(2-methoxyethylidene)hex-3-enyl]formamide |
| SMILES | CC/C=C\C(=C/COC)CNC=O |
| InChI | InChI=1S/C10H17NO2/c1-3-4-5-10(6-7-13-2)8-11-9-12/h4-6,9H,3,7-8H2,1-2H3,(H,11,12)/b5-4-,10-6+ |
| InChIKey | JWWGDSZFRPKCGU-VWJYOPCBSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|