C12H19NO2 — CID 170274732
N-[(3Z,5E)-5-(propan-2-yloxymethyl)hepta-1,3,5-trien-2-yl]formamide (PubChem CID 170274732) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(3Z,5E)-5-(propan-2-yloxymethyl)hepta-1,3,5-trien-2-yl]formamide.
| Compound Name | N-[(3Z,5E)-5-(propan-2-yloxymethyl)hepta-1,3,5-trien-2-yl]formamide |
|---|---|
| PubChem CID | 170274732 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(3Z,5E)-5-(propan-2-yloxymethyl)hepta-1,3,5-trien-2-yl]formamide |
| SMILES | C=C(/C=C\C(=C/C)COC(C)C)NC=O |
| InChI | InChI=1S/C12H19NO2/c1-5-12(8-15-10(2)3)7-6-11(4)13-9-14/h5-7,9-10H,4,8H2,1-3H3,(H,13,14)/b7-6-,12-5+ |
| InChIKey | FNTKPDLBXNEMFI-BZNMCICSSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|