About 2-methylpiperazine;3-propyl-1H-indole
2-methylpiperazine;3-propyl-1H-indole (PubChem CID 143269934) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-methylpiperazine;3-propyl-1H-indole.
Molecular Properties
| Compound Name | 2-methylpiperazine;3-propyl-1H-indole |
| PubChem CID | 143269934 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-methylpiperazine;3-propyl-1H-indole |
| SMILES | CC1CNCCN1.CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H13N.C5H12N2/c1-2-5-9-8-12-11-7-4-3-6-10(9)11;1-5-4-6-2-3-7-5/h3-4,6-8,12H,2,5H2,1H3;5-7H,2-4H2,1H3 |
| InChIKey | CRQMTVZOMCWRDL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpiperazine;3-propyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpiperazine;3-propyl-1H-indole?
The IUPAC name of 2-methylpiperazine;3-propyl-1H-indole (CID 143269934) is 2-methylpiperazine;3-propyl-1H-indole.
What is the SMILES notation for 2-methylpiperazine;3-propyl-1H-indole?
The canonical SMILES for 2-methylpiperazine;3-propyl-1H-indole is CC1CNCCN1.CCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-methylpiperazine;3-propyl-1H-indole?
The InChIKey is CRQMTVZOMCWRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.C5H12N2/c1-2-5-9-8-12-11-7-4-3-6-10(9)11;1-5-4-6-2-3-7-5/h3-4,6-8,12H,2,5H2,1H3;5-7H,2-4H2,1H3.
What are the key properties of 2-methylpiperazine;3-propyl-1H-indole?
2-methylpiperazine;3-propyl-1H-indole has a molecular weight of 259.40 g/mol, XLogP of 2.69, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpiperazine;3-propyl-1H-indole is sourced from PubChem (CID 143269934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).