C13H16N2O2S — CID 143273820
2-amino-1,3-thiazol-4-one;5-methoxy-2,3-dihydro-1H-indene (PubChem CID 143273820) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-amino-1,3-thiazol-4-one;5-methoxy-2,3-dihydro-1H-indene.
| Compound Name | 2-amino-1,3-thiazol-4-one;5-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 143273820 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-amino-1,3-thiazol-4-one;5-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)CCC2.NC1=NC(=O)CS1 |
| InChI | InChI=1S/C10H12O.C3H4N2OS/c1-11-10-6-5-8-3-2-4-9(8)7-10;4-3-5-2(6)1-7-3/h5-7H,2-4H2,1H3;1H2,(H2,4,5,6) |
| InChIKey | JDCHYASKZFIMII-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |