C11H14NO2+ — CID 21080187
7-methoxy-1,3,4,5-tetrahydro-2-benzazepin-2-ium 2-oxide (PubChem CID 21080187) has the molecular formula C11H14NO2+ and a molecular weight of 192.24 g/mol. Its IUPAC name is 7-methoxy-1,3,4,5-tetrahydro-2-benzazepin-2-ium 2-oxide.
| Compound Name | 7-methoxy-1,3,4,5-tetrahydro-2-benzazepin-2-ium 2-oxide |
|---|---|
| PubChem CID | 21080187 |
| Molecular Formula | C11H14NO2+ |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 7-methoxy-1,3,4,5-tetrahydro-2-benzazepin-2-ium 2-oxide |
| SMILES | COc1ccc2c(c1)CCC[N+](=O)C2 |
| InChI | InChI=1S/C11H14NO2/c1-14-11-5-4-10-8-12(13)6-2-3-9(10)7-11/h4-5,7H,2-3,6,8H2,1H3/q+1 |
| InChIKey | YHEFDUFOFISWQI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|