C7H8F6N2O4S — CID 143274477
1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate (PubChem CID 143274477) has the molecular formula C7H8F6N2O4S and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate.
| Compound Name | 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 143274477 |
| Molecular Formula | C7H8F6N2O4S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 1-methyl-1H-imidazol-1-ium;1,1,2-trifluoro-2-(trifluoromethoxy)ethanesulfonate |
| SMILES | C[NH+]1C=CN=C1.O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)F |
| InChI | InChI=1S/C4H6N2.C3H2F6O4S/c1-6-3-2-5-4-6;4-1(13-3(7,8)9)2(5,6)14(10,11)12/h2-4H,1H3;1H,(H,10,11,12) |
| InChIKey | FVRKXTGJDVWHFX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|