About ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane
ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane (PubChem CID 143276149) has the molecular formula C12H19ClO3S
and a molecular weight of 278.80 g/mol. Its IUPAC name is ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane.
Molecular Properties
| Compound Name | ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane |
| PubChem CID | 143276149 |
| Molecular Formula | C12H19ClO3S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane |
| SMILES | CCC.CCOC(=O)c1sc(C(C)O)cc1Cl |
| InChI | InChI=1S/C9H11ClO3S.C3H8/c1-3-13-9(12)8-6(10)4-7(14-8)5(2)11;1-3-2/h4-5,11H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | MMCBDMCEPYALET-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane?
The IUPAC name of ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane (CID 143276149) is ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane.
What is the SMILES notation for ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane?
The canonical SMILES for ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane is CCC.CCOC(=O)c1sc(C(C)O)cc1Cl.
What is the InChIKey of ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane?
The InChIKey is MMCBDMCEPYALET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3S.C3H8/c1-3-13-9(12)8-6(10)4-7(14-8)5(2)11;1-3-2/h4-5,11H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane?
ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane has a molecular weight of 278.80 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chloro-5-(1-hydroxyethyl)thiophene-2-carboxylate;propane is sourced from PubChem (CID 143276149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).