C30H26F6N7O5- — CID 143282280
1-[2-[4-[4-[hydroxy(oxido)amino]phenyl]piperazine-1-carbonyl]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 143282280) has the molecular formula C30H26F6N7O5- and a molecular weight of 678.57 g/mol. Its IUPAC name is 1-[2-[4-[4-[hydroxy(oxido)amino]phenyl]piperazine-1-carbonyl]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[4-[4-[hydroxy(oxido)amino]phenyl]piperazine-1-carbonyl]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 143282280 |
| Molecular Formula | C30H26F6N7O5- |
| Molecular Weight | 678.57 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 1-[2-[4-[4-[hydroxy(oxido)amino]phenyl]piperazine-1-carbonyl]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1cn(Cc2ccc(C(F)(F)F)cc2)c(C(=O)N2CCN(c3ccc(N([O-])O)cc3)CC2)n1 |
| InChI | InChI=1S/C30H26F6N7O5/c31-29(32,33)20-3-1-19(2-4-20)17-42-18-25(39-28(45)37-21-5-11-24(12-6-21)48-30(34,35)36)38-26(42)27(44)41-15-13-40(14-16-41)22-7-9-23(10-8-22)43(46)47/h1-12,18,46H,13-17H2,(H2,37,39,45)/q-1 |
| InChIKey | UKIUNEKLMLYLGC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|