About 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene)
1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) (PubChem CID 143283138) has the molecular formula C40H64F2O3
and a molecular weight of 630.95 g/mol. Its IUPAC name is 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene).
Molecular Properties
| Compound Name | 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) |
| PubChem CID | 143283138 |
| Molecular Formula | C40H64F2O3 |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.48 |
| IUPAC Name | 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) |
| SMILES | CC.CC.CCCCCOc1ccccc1C.CCCCCOc1ccccc1C.COCCCCCc1cccc(F)c1F |
| InChI | InChI=1S/C12H16F2O.2C12H18O.2C2H6/c1-15-9-4-2-3-6-10-7-5-8-11(13)12(10)14;2*1-3-4-7-10-13-12-9-6-5-8-11(12)2;2*1-2/h5,7-8H,2-4,6,9H2,1H3;2*5-6,8-9H,3-4,7,10H2,1-2H3;2*1-2H3 |
| InChIKey | GAHOZUVUQQGFKK-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene)?
The IUPAC name of 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) (CID 143283138) is 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene).
What is the SMILES notation for 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene)?
The canonical SMILES for 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) is CC.CC.CCCCCOc1ccccc1C.CCCCCOc1ccccc1C.COCCCCCc1cccc(F)c1F.
What is the InChIKey of 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene)?
The InChIKey is GAHOZUVUQQGFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O.2C12H18O.2C2H6/c1-15-9-4-2-3-6-10-7-5-8-11(13)12(10)14;2*1-3-4-7-10-13-12-9-6-5-8-11(12)2;2*1-2/h5,7-8H,2-4,6,9H2,1H3;2*5-6,8-9H,3-4,7,10H2,1-2H3;2*1-2H3.
What are the key properties of 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene)?
1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) has a molecular weight of 630.95 g/mol, XLogP of 12.50, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) is sourced from PubChem (CID 143283138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).