C40H64F2O3 — CID 143283138
1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) (PubChem CID 143283138) has the molecular formula C40H64F2O3 and a molecular weight of 630.95 g/mol. Its IUPAC name is 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene).
| Compound Name | 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) |
|---|---|
| PubChem CID | 143283138 |
| Molecular Formula | C40H64F2O3 |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.48 |
| IUPAC Name | 1,2-difluoro-3-(5-methoxypentyl)benzene;ethane;bis(1-methyl-2-pentoxybenzene) |
| SMILES | CC.CC.CCCCCOc1ccccc1C.CCCCCOc1ccccc1C.COCCCCCc1cccc(F)c1F |
| InChI | InChI=1S/C12H16F2O.2C12H18O.2C2H6/c1-15-9-4-2-3-6-10-7-5-8-11(13)12(10)14;2*1-3-4-7-10-13-12-9-6-5-8-11(12)2;2*1-2/h5,7-8H,2-4,6,9H2,1H3;2*5-6,8-9H,3-4,7,10H2,1-2H3;2*1-2H3 |
| InChIKey | GAHOZUVUQQGFKK-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|