About 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane
1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane (PubChem CID 174924769) has the molecular formula C20H27F3O
and a molecular weight of 340.43 g/mol. Its IUPAC name is 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane.
Molecular Properties
| Compound Name | 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane |
| PubChem CID | 174924769 |
| Molecular Formula | C20H27F3O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane |
| SMILES | CCCCCCc1ccccc1F.COC.Fc1cccc(F)c1 |
| InChI | InChI=1S/C12H17F.C6H4F2.C2H6O/c1-2-3-4-5-8-11-9-6-7-10-12(11)13;7-5-2-1-3-6(8)4-5;1-3-2/h6-7,9-10H,2-5,8H2,1H3;1-4H;1-2H3 |
| InChIKey | FKFCWXGHTVNJTG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane?
The IUPAC name of 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane (CID 174924769) is 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane.
What is the SMILES notation for 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane?
The canonical SMILES for 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane is CCCCCCc1ccccc1F.COC.Fc1cccc(F)c1.
What is the InChIKey of 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane?
The InChIKey is FKFCWXGHTVNJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F.C6H4F2.C2H6O/c1-2-3-4-5-8-11-9-6-7-10-12(11)13;7-5-2-1-3-6(8)4-5;1-3-2/h6-7,9-10H,2-5,8H2,1H3;1-4H;1-2H3.
What are the key properties of 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane?
1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane has a molecular weight of 340.43 g/mol, XLogP of 6.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorobenzene;1-fluoro-2-hexylbenzene;methoxymethane is sourced from PubChem (CID 174924769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).