C17H20FNO3S — CID 143289124
N-ethyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-methylsulfonylbenzamide (PubChem CID 143289124) has the molecular formula C17H20FNO3S and a molecular weight of 337.42 g/mol. Its IUPAC name is N-ethyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-methylsulfonylbenzamide.
| Compound Name | N-ethyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 143289124 |
| Molecular Formula | C17H20FNO3S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-ethyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-methylsulfonylbenzamide |
| SMILES | C=C(/C=C\C(F)=C/C)c1ccc(S(C)(=O)=O)cc1C(=O)NCC |
| InChI | InChI=1S/C17H20FNO3S/c1-5-13(18)8-7-12(3)15-10-9-14(23(4,21)22)11-16(15)17(20)19-6-2/h5,7-11H,3,6H2,1-2,4H3,(H,19,20)/b8-7-,13-5+ |
| InChIKey | PYOZVABKHZVUGK-XYGSGGKESA-N |
| XLogP | 3.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|