C21H34N2O2S — CID 143290615
ethyl (E)-5-methyl-2-[[(E)-3-phenylprop-2-enylidene]amino]hex-2-enoate;methanamine;methylsulfanylmethane (PubChem CID 143290615) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is ethyl (E)-5-methyl-2-[[(E)-3-phenylprop-2-enylidene]amino]hex-2-enoate;methanamine;methylsulfanylmethane.
| Compound Name | ethyl (E)-5-methyl-2-[[(E)-3-phenylprop-2-enylidene]amino]hex-2-enoate;methanamine;methylsulfanylmethane |
|---|---|
| PubChem CID | 143290615 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | ethyl (E)-5-methyl-2-[[(E)-3-phenylprop-2-enylidene]amino]hex-2-enoate;methanamine;methylsulfanylmethane |
| SMILES | CCOC(=O)C(=C\CC(C)C)/N=C/C=C/c1ccccc1.CN.CSC |
| InChI | InChI=1S/C18H23NO2.C2H6S.CH5N/c1-4-21-18(20)17(13-12-15(2)3)19-14-8-11-16-9-6-5-7-10-16;1-3-2;1-2/h5-11,13-15H,4,12H2,1-3H3;1-2H3;2H2,1H3/b11-8+,17-13+,19-14+;; |
| InChIKey | KWGRYMVTIMQLQO-YSSNCQEDSA-N |
| XLogP | 4.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|