C17H25NO2 — CID 143290658
pentan-2-yl 2-cyano-5-methyl-3-(2-methylprop-1-enyl)hexa-2,4-dienoate (PubChem CID 143290658) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is pentan-2-yl 2-cyano-5-methyl-3-(2-methylprop-1-enyl)hexa-2,4-dienoate.
| Compound Name | pentan-2-yl 2-cyano-5-methyl-3-(2-methylprop-1-enyl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 143290658 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | pentan-2-yl 2-cyano-5-methyl-3-(2-methylprop-1-enyl)hexa-2,4-dienoate |
| SMILES | CCCC(C)OC(=O)C(C#N)=C(C=C(C)C)C=C(C)C |
| InChI | InChI=1S/C17H25NO2/c1-7-8-14(6)20-17(19)16(11-18)15(9-12(2)3)10-13(4)5/h9-10,14H,7-8H2,1-6H3 |
| InChIKey | PCDMXWSETQHPMA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|