C12H17NO2 — CID 5381951
propan-2-yl (2E)-2-cyano-3,5-dimethylhexa-2,4-dienoate (PubChem CID 5381951) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is propan-2-yl (2E)-2-cyano-3,5-dimethylhexa-2,4-dienoate.
| Compound Name | propan-2-yl (2E)-2-cyano-3,5-dimethylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 5381951 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | propan-2-yl (2E)-2-cyano-3,5-dimethylhexa-2,4-dienoate |
| SMILES | CC(C)=C/C(C)=C(\C#N)C(=O)OC(C)C |
| InChI | InChI=1S/C12H17NO2/c1-8(2)6-10(5)11(7-13)12(14)15-9(3)4/h6,9H,1-5H3/b11-10+ |
| InChIKey | JACFAGXEIOQLCE-ZHACJKMWSA-N |
| XLogP | 2.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|