C22H28N2O10 — CID 163177710
[1,6-diacetyloxy-5-(2-cyano-3-methylbut-2-enoyl)oxy-3,4-dihydroxyhexan-2-yl] 2-cyano-3-methylbut-2-enoate (PubChem CID 163177710) has the molecular formula C22H28N2O10 and a molecular weight of 480.47 g/mol. Its IUPAC name is [1,6-diacetyloxy-5-(2-cyano-3-methylbut-2-enoyl)oxy-3,4-dihydroxyhexan-2-yl] 2-cyano-3-methylbut-2-enoate.
| Compound Name | [1,6-diacetyloxy-5-(2-cyano-3-methylbut-2-enoyl)oxy-3,4-dihydroxyhexan-2-yl] 2-cyano-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163177710 |
| Molecular Formula | C22H28N2O10 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [1,6-diacetyloxy-5-(2-cyano-3-methylbut-2-enoyl)oxy-3,4-dihydroxyhexan-2-yl] 2-cyano-3-methylbut-2-enoate |
| SMILES | CC(=O)OCC(OC(=O)C(C#N)=C(C)C)C(O)C(O)C(COC(C)=O)OC(=O)C(C#N)=C(C)C |
| InChI | InChI=1S/C22H28N2O10/c1-11(2)15(7-23)21(29)33-17(9-31-13(5)25)19(27)20(28)18(10-32-14(6)26)34-22(30)16(8-24)12(3)4/h17-20,27-28H,9-10H2,1-6H3 |
| InChIKey | XYDOZYBSXYPCCS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 193.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|